C30H37F3N4 — CID 171097468
N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;3-(3,3-difluorocyclobutyl)-2-fluoropyridine;2-prop-2-enyl-3H-pyrrole (PubChem CID 171097468) has the molecular formula C30H37F3N4 and a molecular weight of 510.65 g/mol. Its IUPAC name is N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;3-(3,3-difluorocyclobutyl)-2-fluoropyridine;2-prop-2-enyl-3H-pyrrole.
| Compound Name | N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;3-(3,3-difluorocyclobutyl)-2-fluoropyridine;2-prop-2-enyl-3H-pyrrole |
|---|---|
| PubChem CID | 171097468 |
| Molecular Formula | C30H37F3N4 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;3-(3,3-difluorocyclobutyl)-2-fluoropyridine;2-prop-2-enyl-3H-pyrrole |
| SMILES | C=C(NCc1ccccc1)C1CCCN1C.C=CCC1=NC=CC1.Fc1ncccc1C1CC(F)(F)C1 |
| InChI | InChI=1S/C14H20N2.C9H8F3N.C7H9N/c1-12(14-9-6-10-16(14)2)15-11-13-7-4-3-5-8-13;10-8-7(2-1-3-13-8)6-4-9(11,12)5-6;1-2-4-7-5-3-6-8-7/h3-5,7-8,14-15H,1,6,9-11H2,2H3;1-3,6H,4-5H2;2-3,6H,1,4-5H2 |
| InChIKey | PCVKZLBQGPPSIQ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|