C31H46N4 — CID 165139449
N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;4-ethenyl-1-prop-1-en-2-ylpiperidine;phenylmethanamine (PubChem CID 165139449) has the molecular formula C31H46N4 and a molecular weight of 474.74 g/mol. Its IUPAC name is N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;4-ethenyl-1-prop-1-en-2-ylpiperidine;phenylmethanamine.
| Compound Name | N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;4-ethenyl-1-prop-1-en-2-ylpiperidine;phenylmethanamine |
|---|---|
| PubChem CID | 165139449 |
| Molecular Formula | C31H46N4 |
| Molecular Weight | 474.74 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | N-benzyl-1-(1-methylpyrrolidin-2-yl)ethenamine;4-ethenyl-1-prop-1-en-2-ylpiperidine;phenylmethanamine |
| SMILES | C=C(NCc1ccccc1)C1CCCN1C.C=CC1CCN(C(=C)C)CC1.NCc1ccccc1 |
| InChI | InChI=1S/C14H20N2.C10H17N.C7H9N/c1-12(14-9-6-10-16(14)2)15-11-13-7-4-3-5-8-13;1-4-10-5-7-11(8-6-10)9(2)3;8-6-7-4-2-1-3-5-7/h3-5,7-8,14-15H,1,6,9-11H2,2H3;4,10H,1-2,5-8H2,3H3;1-5H,6,8H2 |
| InChIKey | FSEWENYEPVUVKG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.74 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|