C21H23ClF3N3O — CID 69104804
4-amino-3-chloro-N-[(1-methylpiperidin-2-yl)-phenylmethyl]-5-(trifluoromethyl)benzamide (PubChem CID 69104804) has the molecular formula C21H23ClF3N3O and a molecular weight of 425.88 g/mol. Its IUPAC name is 4-amino-3-chloro-N-[(1-methylpiperidin-2-yl)-phenylmethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 4-amino-3-chloro-N-[(1-methylpiperidin-2-yl)-phenylmethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 69104804 |
| Molecular Formula | C21H23ClF3N3O |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 4-amino-3-chloro-N-[(1-methylpiperidin-2-yl)-phenylmethyl]-5-(trifluoromethyl)benzamide |
| SMILES | CN1CCCCC1C(NC(=O)c1cc(Cl)c(N)c(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C21H23ClF3N3O/c1-28-10-6-5-9-17(28)19(13-7-3-2-4-8-13)27-20(29)14-11-15(21(23,24)25)18(26)16(22)12-14/h2-4,7-8,11-12,17,19H,5-6,9-10,26H2,1H3,(H,27,29) |
| InChIKey | CVJATLHDPHUMED-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|