C21H24Cl2N2O — CID 129152159
2,3-dichloro-N-[(S)-[(2S)-1-methylazepan-2-yl]-phenylmethyl]benzamide (PubChem CID 129152159) has the molecular formula C21H24Cl2N2O and a molecular weight of 391.34 g/mol. Its IUPAC name is 2,3-dichloro-N-[(S)-[(2S)-1-methylazepan-2-yl]-phenylmethyl]benzamide.
| Compound Name | 2,3-dichloro-N-[(S)-[(2S)-1-methylazepan-2-yl]-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 129152159 |
| Molecular Formula | C21H24Cl2N2O |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2,3-dichloro-N-[(S)-[(2S)-1-methylazepan-2-yl]-phenylmethyl]benzamide |
| SMILES | CN1CCCCC[C@H]1[C@@H](NC(=O)c1cccc(Cl)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C21H24Cl2N2O/c1-25-14-7-3-6-13-18(25)20(15-9-4-2-5-10-15)24-21(26)16-11-8-12-17(22)19(16)23/h2,4-5,8-12,18,20H,3,6-7,13-14H2,1H3,(H,24,26)/t18-,20-/m0/s1 |
| InChIKey | PRYDTJHNVSBUFV-ICSRJNTNSA-N |
| XLogP | 5.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |