C22H21ClF6N2O4S — CID 87727068
[3-[[[2-chloro-3-(trifluoromethyl)benzoyl]amino]-[(2S)-1-methylpiperidin-2-yl]methyl]phenyl] trifluoromethanesulfonate (PubChem CID 87727068) has the molecular formula C22H21ClF6N2O4S and a molecular weight of 558.93 g/mol. Its IUPAC name is [3-[[[2-chloro-3-(trifluoromethyl)benzoyl]amino]-[(2S)-1-methylpiperidin-2-yl]methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[[[2-chloro-3-(trifluoromethyl)benzoyl]amino]-[(2S)-1-methylpiperidin-2-yl]methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87727068 |
| Molecular Formula | C22H21ClF6N2O4S |
| Molecular Weight | 558.93 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | [3-[[[2-chloro-3-(trifluoromethyl)benzoyl]amino]-[(2S)-1-methylpiperidin-2-yl]methyl]phenyl] trifluoromethanesulfonate |
| SMILES | CN1CCCC[C@H]1C(NC(=O)c1cccc(C(F)(F)F)c1Cl)c1cccc(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21ClF6N2O4S/c1-31-11-3-2-10-17(31)19(13-6-4-7-14(12-13)35-36(33,34)22(27,28)29)30-20(32)15-8-5-9-16(18(15)23)21(24,25)26/h4-9,12,17,19H,2-3,10-11H2,1H3,(H,30,32)/t17-,19?/m0/s1 |
| InChIKey | JNHJVLYSUQYTSM-KKFHFHRHSA-N |
| XLogP | 5.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.93 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|