C22H25ClF3N2O+ — CID 69104903
2-chloro-N-[(S)-[(2S)-1,1-dimethylpiperidin-1-ium-2-yl]-phenylmethyl]-3-(trifluoromethyl)benzamide (PubChem CID 69104903) has the molecular formula C22H25ClF3N2O+ and a molecular weight of 425.90 g/mol. Its IUPAC name is 2-chloro-N-[(S)-[(2S)-1,1-dimethylpiperidin-1-ium-2-yl]-phenylmethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[(S)-[(2S)-1,1-dimethylpiperidin-1-ium-2-yl]-phenylmethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 69104903 |
| Molecular Formula | C22H25ClF3N2O+ |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-chloro-N-[(S)-[(2S)-1,1-dimethylpiperidin-1-ium-2-yl]-phenylmethyl]-3-(trifluoromethyl)benzamide |
| SMILES | C[N+]1(C)CCCC[C@H]1[C@@H](NC(=O)c1cccc(C(F)(F)F)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H24ClF3N2O/c1-28(2)14-7-6-13-18(28)20(15-9-4-3-5-10-15)27-21(29)16-11-8-12-17(19(16)23)22(24,25)26/h3-5,8-12,18,20H,6-7,13-14H2,1-2H3/p+1/t18-,20-/m0/s1 |
| InChIKey | IHTKMZAEJJUWPW-ICSRJNTNSA-O |
| XLogP | 5.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|