C19H20ClF3N2OS — CID 11408387
2-chloro-N-[(1-methylpiperidin-2-yl)-thiophen-3-ylmethyl]-3-(trifluoromethyl)benzamide (PubChem CID 11408387) has the molecular formula C19H20ClF3N2OS and a molecular weight of 416.90 g/mol. Its IUPAC name is 2-chloro-N-[(1-methylpiperidin-2-yl)-thiophen-3-ylmethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[(1-methylpiperidin-2-yl)-thiophen-3-ylmethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 11408387 |
| Molecular Formula | C19H20ClF3N2OS |
| Molecular Weight | 416.90 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-chloro-N-[(1-methylpiperidin-2-yl)-thiophen-3-ylmethyl]-3-(trifluoromethyl)benzamide |
| SMILES | CN1CCCCC1C(NC(=O)c1cccc(C(F)(F)F)c1Cl)c1ccsc1 |
| InChI | InChI=1S/C19H20ClF3N2OS/c1-25-9-3-2-7-15(25)17(12-8-10-27-11-12)24-18(26)13-5-4-6-14(16(13)20)19(21,22)23/h4-6,8,10-11,15,17H,2-3,7,9H2,1H3,(H,24,26) |
| InChIKey | VAKIYBTWCJOZDF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.90 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |