C24H27F3N2O — CID 24984434
N-[1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl(phenyl)methyl]-2-methyl-3-(trifluoromethyl)benzamide (PubChem CID 24984434) has the molecular formula C24H27F3N2O and a molecular weight of 416.49 g/mol. Its IUPAC name is N-[1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl(phenyl)methyl]-2-methyl-3-(trifluoromethyl)benzamide.
| Compound Name | N-[1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl(phenyl)methyl]-2-methyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 24984434 |
| Molecular Formula | C24H27F3N2O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-[1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl(phenyl)methyl]-2-methyl-3-(trifluoromethyl)benzamide |
| SMILES | Cc1c(C(=O)NC(c2ccccc2)C2CCC3CCCCN32)cccc1C(F)(F)F |
| InChI | InChI=1S/C24H27F3N2O/c1-16-19(11-7-12-20(16)24(25,26)27)23(30)28-22(17-8-3-2-4-9-17)21-14-13-18-10-5-6-15-29(18)21/h2-4,7-9,11-12,18,21-22H,5-6,10,13-15H2,1H3,(H,28,30) |
| InChIKey | WNXXIGDXAYOBPF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |