C22H22ClF3N2O — CID 24984765
2-chloro-N-[2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl(phenyl)methyl]-3-(trifluoromethyl)benzamide (PubChem CID 24984765) has the molecular formula C22H22ClF3N2O and a molecular weight of 422.88 g/mol. Its IUPAC name is 2-chloro-N-[2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl(phenyl)methyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl(phenyl)methyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 24984765 |
| Molecular Formula | C22H22ClF3N2O |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2-chloro-N-[2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl(phenyl)methyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NC(c1ccccc1)C1CCC2CCCN21)c1cccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C22H22ClF3N2O/c23-19-16(9-4-10-17(19)22(24,25)26)21(29)27-20(14-6-2-1-3-7-14)18-12-11-15-8-5-13-28(15)18/h1-4,6-7,9-10,15,18,20H,5,8,11-13H2,(H,27,29) |
| InChIKey | YOUQCLPFELOPDM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |