C25H25ClF6N2O4S — CID 87727288
[5-[[[2-chloro-3-(trifluoromethyl)benzoyl]amino]-[(2S)-1-prop-2-enylpiperidin-2-yl]methyl]-2-methylphenyl] trifluoromethanesulfonate (PubChem CID 87727288) has the molecular formula C25H25ClF6N2O4S and a molecular weight of 598.99 g/mol. Its IUPAC name is [5-[[[2-chloro-3-(trifluoromethyl)benzoyl]amino]-[(2S)-1-prop-2-enylpiperidin-2-yl]methyl]-2-methylphenyl] trifluoromethanesulfonate.
| Compound Name | [5-[[[2-chloro-3-(trifluoromethyl)benzoyl]amino]-[(2S)-1-prop-2-enylpiperidin-2-yl]methyl]-2-methylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87727288 |
| Molecular Formula | C25H25ClF6N2O4S |
| Molecular Weight | 598.99 g/mol |
| Exact Mass | 598.11 |
| IUPAC Name | [5-[[[2-chloro-3-(trifluoromethyl)benzoyl]amino]-[(2S)-1-prop-2-enylpiperidin-2-yl]methyl]-2-methylphenyl] trifluoromethanesulfonate |
| SMILES | C=CCN1CCCC[C@H]1C(NC(=O)c1cccc(C(F)(F)F)c1Cl)c1ccc(C)c(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C25H25ClF6N2O4S/c1-3-12-34-13-5-4-9-19(34)22(33-23(35)17-7-6-8-18(21(17)26)24(27,28)29)16-11-10-15(2)20(14-16)38-39(36,37)25(30,31)32/h3,6-8,10-11,14,19,22H,1,4-5,9,12-13H2,2H3,(H,33,35)/t19-,22?/m0/s1 |
| InChIKey | OIPUHJOLRMUCMF-YDNXMHBPSA-N |
| XLogP | 6.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.99 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|