C22H24Cl2N2O — CID 67165261
2,3-dichloro-N-[(S)-phenyl-[(2S)-1-prop-2-enylpiperidin-2-yl]methyl]benzamide (PubChem CID 67165261) has the molecular formula C22H24Cl2N2O and a molecular weight of 403.35 g/mol. Its IUPAC name is 2,3-dichloro-N-[(S)-phenyl-[(2S)-1-prop-2-enylpiperidin-2-yl]methyl]benzamide.
| Compound Name | 2,3-dichloro-N-[(S)-phenyl-[(2S)-1-prop-2-enylpiperidin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 67165261 |
| Molecular Formula | C22H24Cl2N2O |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2,3-dichloro-N-[(S)-phenyl-[(2S)-1-prop-2-enylpiperidin-2-yl]methyl]benzamide |
| SMILES | C=CCN1CCCC[C@H]1[C@@H](NC(=O)c1cccc(Cl)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H24Cl2N2O/c1-2-14-26-15-7-6-13-19(26)21(16-9-4-3-5-10-16)25-22(27)17-11-8-12-18(23)20(17)24/h2-5,8-12,19,21H,1,6-7,13-15H2,(H,25,27)/t19-,21-/m0/s1 |
| InChIKey | XCPSOJPWIPRXMP-FPOVZHCZSA-N |
| XLogP | 5.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|