C20H24Cl3N3O — CID 67165144
4-amino-3,5-dichloro-N-[(R)-[(2R)-1-methylpiperidin-2-yl]-phenylmethyl]benzamide;hydrochloride (PubChem CID 67165144) has the molecular formula C20H24Cl3N3O and a molecular weight of 428.79 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-[(R)-[(2R)-1-methylpiperidin-2-yl]-phenylmethyl]benzamide;hydrochloride.
| Compound Name | 4-amino-3,5-dichloro-N-[(R)-[(2R)-1-methylpiperidin-2-yl]-phenylmethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 67165144 |
| Molecular Formula | C20H24Cl3N3O |
| Molecular Weight | 428.79 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 4-amino-3,5-dichloro-N-[(R)-[(2R)-1-methylpiperidin-2-yl]-phenylmethyl]benzamide;hydrochloride |
| SMILES | CN1CCCC[C@@H]1[C@H](NC(=O)c1cc(Cl)c(N)c(Cl)c1)c1ccccc1.Cl |
| InChI | InChI=1S/C20H23Cl2N3O.ClH/c1-25-10-6-5-9-17(25)19(13-7-3-2-4-8-13)24-20(26)14-11-15(21)18(23)16(22)12-14;/h2-4,7-8,11-12,17,19H,5-6,9-10,23H2,1H3,(H,24,26);1H/t17-,19-;/m1./s1 |
| InChIKey | RWHJUICSENDGPF-POCMBTLOSA-N |
| XLogP | 4.95 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.79 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|