C21H25FN6O — CID 68740421
1-(3-amino-7-fluoro-1H-indazol-5-yl)-3-[(1-methylpiperidin-2-yl)-phenylmethyl]urea (PubChem CID 68740421) has the molecular formula C21H25FN6O and a molecular weight of 396.47 g/mol. Its IUPAC name is 1-(3-amino-7-fluoro-1H-indazol-5-yl)-3-[(1-methylpiperidin-2-yl)-phenylmethyl]urea.
| Compound Name | 1-(3-amino-7-fluoro-1H-indazol-5-yl)-3-[(1-methylpiperidin-2-yl)-phenylmethyl]urea |
|---|---|
| PubChem CID | 68740421 |
| Molecular Formula | C21H25FN6O |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 1-(3-amino-7-fluoro-1H-indazol-5-yl)-3-[(1-methylpiperidin-2-yl)-phenylmethyl]urea |
| SMILES | CN1CCCCC1C(NC(=O)Nc1cc(F)c2[nH]nc(N)c2c1)c1ccccc1 |
| InChI | InChI=1S/C21H25FN6O/c1-28-10-6-5-9-17(28)18(13-7-3-2-4-8-13)25-21(29)24-14-11-15-19(16(22)12-14)26-27-20(15)23/h2-4,7-8,11-12,17-18H,5-6,9-10H2,1H3,(H3,23,26,27)(H2,24,25,29) |
| InChIKey | SEVVSZKEEOEDPM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |