C26H28N6O — CID 25152352
1-[[(2S)-1-methylpiperidin-2-yl]-phenylmethyl]-3-(3-pyridin-2-yl-1H-indazol-5-yl)urea (PubChem CID 25152352) has the molecular formula C26H28N6O and a molecular weight of 440.55 g/mol. Its IUPAC name is 1-[[(2S)-1-methylpiperidin-2-yl]-phenylmethyl]-3-(3-pyridin-2-yl-1H-indazol-5-yl)urea.
| Compound Name | 1-[[(2S)-1-methylpiperidin-2-yl]-phenylmethyl]-3-(3-pyridin-2-yl-1H-indazol-5-yl)urea |
|---|---|
| PubChem CID | 25152352 |
| Molecular Formula | C26H28N6O |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 1-[[(2S)-1-methylpiperidin-2-yl]-phenylmethyl]-3-(3-pyridin-2-yl-1H-indazol-5-yl)urea |
| SMILES | CN1CCCC[C@H]1C(NC(=O)Nc1ccc2[nH]nc(-c3ccccn3)c2c1)c1ccccc1 |
| InChI | InChI=1S/C26H28N6O/c1-32-16-8-6-12-23(32)24(18-9-3-2-4-10-18)29-26(33)28-19-13-14-21-20(17-19)25(31-30-21)22-11-5-7-15-27-22/h2-5,7,9-11,13-15,17,23-24H,6,8,12,16H2,1H3,(H,30,31)(H2,28,29,33)/t23-,24?/m0/s1 |
| InChIKey | CNIMZMHOPVBLQM-UXMRNZNESA-N |
| XLogP | 4.97 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |