C20H25Cl4N3O — CID 67165228
4-amino-3,3,5,5-tetrachloro-N-[(R)-[(2R)-1-methylpiperidin-2-yl]-phenylmethyl]cyclohexene-1-carboxamide (PubChem CID 67165228) has the molecular formula C20H25Cl4N3O and a molecular weight of 465.25 g/mol. Its IUPAC name is 4-amino-3,3,5,5-tetrachloro-N-[(R)-[(2R)-1-methylpiperidin-2-yl]-phenylmethyl]cyclohexene-1-carboxamide.
| Compound Name | 4-amino-3,3,5,5-tetrachloro-N-[(R)-[(2R)-1-methylpiperidin-2-yl]-phenylmethyl]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 67165228 |
| Molecular Formula | C20H25Cl4N3O |
| Molecular Weight | 465.25 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 4-amino-3,3,5,5-tetrachloro-N-[(R)-[(2R)-1-methylpiperidin-2-yl]-phenylmethyl]cyclohexene-1-carboxamide |
| SMILES | CN1CCCC[C@@H]1[C@H](NC(=O)C1=CC(Cl)(Cl)C(N)C(Cl)(Cl)C1)c1ccccc1 |
| InChI | InChI=1S/C20H25Cl4N3O/c1-27-10-6-5-9-15(27)16(13-7-3-2-4-8-13)26-17(28)14-11-19(21,22)18(25)20(23,24)12-14/h2-4,7-8,11,15-16,18H,5-6,9-10,12,25H2,1H3,(H,26,28)/t15-,16-,18?/m1/s1 |
| InChIKey | DXKJYIBPQMOSBD-JNIOUFIGSA-N |
| XLogP | 4.33 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.25 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|