C21H25N5O — CID 25153813
1-(1H-indazol-6-yl)-3-[[(2S)-1-methylpiperidin-2-yl]-phenylmethyl]urea (PubChem CID 25153813) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 1-(1H-indazol-6-yl)-3-[[(2S)-1-methylpiperidin-2-yl]-phenylmethyl]urea.
| Compound Name | 1-(1H-indazol-6-yl)-3-[[(2S)-1-methylpiperidin-2-yl]-phenylmethyl]urea |
|---|---|
| PubChem CID | 25153813 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 1-(1H-indazol-6-yl)-3-[[(2S)-1-methylpiperidin-2-yl]-phenylmethyl]urea |
| SMILES | CN1CCCC[C@H]1C(NC(=O)Nc1ccc2cn[nH]c2c1)c1ccccc1 |
| InChI | InChI=1S/C21H25N5O/c1-26-12-6-5-9-19(26)20(15-7-3-2-4-8-15)24-21(27)23-17-11-10-16-14-22-25-18(16)13-17/h2-4,7-8,10-11,13-14,19-20H,5-6,9,12H2,1H3,(H,22,25)(H2,23,24,27)/t19-,20?/m0/s1 |
| InChIKey | LDLBNFRDZSWLGA-XJDOXCRVSA-N |
| XLogP | 3.91 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |