C28H28N6O — CID 68794056
1-[(1-methylpiperidin-2-yl)-phenylmethyl]-3-[3-(2-pyridin-3-ylethynyl)-2H-indazol-5-yl]urea (PubChem CID 68794056) has the molecular formula C28H28N6O and a molecular weight of 464.57 g/mol. Its IUPAC name is 1-[(1-methylpiperidin-2-yl)-phenylmethyl]-3-[3-(2-pyridin-3-ylethynyl)-2H-indazol-5-yl]urea.
| Compound Name | 1-[(1-methylpiperidin-2-yl)-phenylmethyl]-3-[3-(2-pyridin-3-ylethynyl)-2H-indazol-5-yl]urea |
|---|---|
| PubChem CID | 68794056 |
| Molecular Formula | C28H28N6O |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 1-[(1-methylpiperidin-2-yl)-phenylmethyl]-3-[3-(2-pyridin-3-ylethynyl)-2H-indazol-5-yl]urea |
| SMILES | CN1CCCCC1C(NC(=O)Nc1ccc2n[nH]c(C#Cc3cccnc3)c2c1)c1ccccc1 |
| InChI | InChI=1S/C28H28N6O/c1-34-17-6-5-11-26(34)27(21-9-3-2-4-10-21)31-28(35)30-22-13-15-25-23(18-22)24(32-33-25)14-12-20-8-7-16-29-19-20/h2-4,7-10,13,15-16,18-19,26-27H,5-6,11,17H2,1H3,(H,32,33)(H2,30,31,35) |
| InChIKey | MORFHQMAZSSNBC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|