C16H11N3O — CID 22479958
3-(2-phenylethynyl)-2H-indazole-5-carboxamide (PubChem CID 22479958) has the molecular formula C16H11N3O and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-(2-phenylethynyl)-2H-indazole-5-carboxamide.
| Compound Name | 3-(2-phenylethynyl)-2H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 22479958 |
| Molecular Formula | C16H11N3O |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-(2-phenylethynyl)-2H-indazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2n[nH]c(C#Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C16H11N3O/c17-16(20)12-7-9-15-13(10-12)14(18-19-15)8-6-11-4-2-1-3-5-11/h1-5,7,9-10H,(H2,17,20)(H,18,19) |
| InChIKey | HHMXTVMOXKTJFI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|