C17H13FN2O2 — CID 90354457
1-(2-fluorophenyl)-4-(1H-indazol-3-yl)butane-1,4-dione (PubChem CID 90354457) has the molecular formula C17H13FN2O2 and a molecular weight of 296.30 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-(1H-indazol-3-yl)butane-1,4-dione.
| Compound Name | 1-(2-fluorophenyl)-4-(1H-indazol-3-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 90354457 |
| Molecular Formula | C17H13FN2O2 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-(2-fluorophenyl)-4-(1H-indazol-3-yl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1n[nH]c2ccccc12)c1ccccc1F |
| InChI | InChI=1S/C17H13FN2O2/c18-13-7-3-1-5-11(13)15(21)9-10-16(22)17-12-6-2-4-8-14(12)19-20-17/h1-8H,9-10H2,(H,19,20) |
| InChIKey | TWUZLHBXBCKVHM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |