C27H37F2N5 — CID 165140773
(1Z)-4-[2-[1-[(4-fluorophenyl)methylamino]ethenyl]pyrrolidin-1-yl]-2-hydrazinylpenta-1,4-dien-1-amine;1-fluoro-2-propan-2-ylbenzene (PubChem CID 165140773) has the molecular formula C27H37F2N5 and a molecular weight of 469.62 g/mol. Its IUPAC name is (1Z)-4-[2-[1-[(4-fluorophenyl)methylamino]ethenyl]pyrrolidin-1-yl]-2-hydrazinylpenta-1,4-dien-1-amine;1-fluoro-2-propan-2-ylbenzene.
| Compound Name | (1Z)-4-[2-[1-[(4-fluorophenyl)methylamino]ethenyl]pyrrolidin-1-yl]-2-hydrazinylpenta-1,4-dien-1-amine;1-fluoro-2-propan-2-ylbenzene |
|---|---|
| PubChem CID | 165140773 |
| Molecular Formula | C27H37F2N5 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.30 |
| IUPAC Name | (1Z)-4-[2-[1-[(4-fluorophenyl)methylamino]ethenyl]pyrrolidin-1-yl]-2-hydrazinylpenta-1,4-dien-1-amine;1-fluoro-2-propan-2-ylbenzene |
| SMILES | C=C(NCc1ccc(F)cc1)C1CCCN1C(=C)C/C(=C/N)NN.CC(C)c1ccccc1F |
| InChI | InChI=1S/C18H26FN5.C9H11F/c1-13(10-17(11-20)23-21)24-9-3-4-18(24)14(2)22-12-15-5-7-16(19)8-6-15;1-7(2)8-5-3-4-6-9(8)10/h5-8,11,18,22-23H,1-4,9-10,12,20-21H2;3-7H,1-2H3/b17-11-; |
| InChIKey | BTXOUZBAHJEIMR-CULRIWENSA-N |
| XLogP | 5.01 |
| TPSA | 79.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|