C20H25N3 — CID 165140425
N-benzyl-1-[1-[3-(2H-pyrrol-5-yl)prop-1-en-2-yl]pyrrolidin-2-yl]ethenamine (PubChem CID 165140425) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-benzyl-1-[1-[3-(2H-pyrrol-5-yl)prop-1-en-2-yl]pyrrolidin-2-yl]ethenamine.
| Compound Name | N-benzyl-1-[1-[3-(2H-pyrrol-5-yl)prop-1-en-2-yl]pyrrolidin-2-yl]ethenamine |
|---|---|
| PubChem CID | 165140425 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | N-benzyl-1-[1-[3-(2H-pyrrol-5-yl)prop-1-en-2-yl]pyrrolidin-2-yl]ethenamine |
| SMILES | C=C(NCc1ccccc1)C1CCCN1C(=C)CC1=NCC=C1 |
| InChI | InChI=1S/C20H25N3/c1-16(14-19-10-6-12-21-19)23-13-7-11-20(23)17(2)22-15-18-8-4-3-5-9-18/h3-6,8-10,20,22H,1-2,7,11-15H2 |
| InChIKey | AZUYJDDKLJZDLB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |