C17H26N6O — CID 165139638
5-amino-1-[(4Z)-5-amino-4-hydrazinylpenta-1,4-dien-2-yl]-N-benzylpyrrolidine-2-carboxamide (PubChem CID 165139638) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is 5-amino-1-[(4Z)-5-amino-4-hydrazinylpenta-1,4-dien-2-yl]-N-benzylpyrrolidine-2-carboxamide.
| Compound Name | 5-amino-1-[(4Z)-5-amino-4-hydrazinylpenta-1,4-dien-2-yl]-N-benzylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 165139638 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 5-amino-1-[(4Z)-5-amino-4-hydrazinylpenta-1,4-dien-2-yl]-N-benzylpyrrolidine-2-carboxamide |
| SMILES | C=C(C/C(=C/N)NN)N1C(N)CCC1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H26N6O/c1-12(9-14(10-18)22-20)23-15(7-8-16(23)19)17(24)21-11-13-5-3-2-4-6-13/h2-6,10,15-16,22H,1,7-9,11,18-20H2,(H,21,24)/b14-10- |
| InChIKey | HTHNXUFDFBUBLY-UVTDQMKNSA-N |
| XLogP | 0.22 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|