C17H23Cl3N2OS — CID 174269194
2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone;hydrochloride (PubChem CID 174269194) has the molecular formula C17H23Cl3N2OS and a molecular weight of 409.81 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone;hydrochloride.
| Compound Name | 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 174269194 |
| Molecular Formula | C17H23Cl3N2OS |
| Molecular Weight | 409.81 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-[3-(2-iminopentyl)thiomorpholin-4-yl]ethanone;hydrochloride |
| SMILES | Cl.[H]/N=C(\CCC)CC1CSCCN1C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H22Cl2N2OS.ClH/c1-2-3-13(20)10-14-11-23-7-6-21(14)17(22)9-12-4-5-15(18)16(19)8-12;/h4-5,8,14,20H,2-3,6-7,9-11H2,1H3;1H/b20-13+; |
| InChIKey | HOOJCBYKZWCYEB-UNUAAEKOSA-N |
| XLogP | 5.11 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.81 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|