C16H18Cl2N4O2S — CID 135819543
N-butyl-2-[[6-[(3,4-dichlorophenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]acetamide (PubChem CID 135819543) has the molecular formula C16H18Cl2N4O2S and a molecular weight of 401.32 g/mol. Its IUPAC name is N-butyl-2-[[6-[(3,4-dichlorophenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]acetamide.
| Compound Name | N-butyl-2-[[6-[(3,4-dichlorophenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135819543 |
| Molecular Formula | C16H18Cl2N4O2S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | N-butyl-2-[[6-[(3,4-dichlorophenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]acetamide |
| SMILES | CCCCNC(=O)CSc1nnc(Cc2ccc(Cl)c(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H18Cl2N4O2S/c1-2-3-6-19-14(23)9-25-16-20-15(24)13(21-22-16)8-10-4-5-11(17)12(18)7-10/h4-5,7H,2-3,6,8-9H2,1H3,(H,19,23)(H,20,22,24) |
| InChIKey | DVWOKHMCWKXNDT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|