C20H29ClFN2+ — CID 174269412
1-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-3-(2,2,4,4-tetramethylpentyl)imidazol-1-ium (PubChem CID 174269412) has the molecular formula C20H29ClFN2+ and a molecular weight of 351.92 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-3-(2,2,4,4-tetramethylpentyl)imidazol-1-ium.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-3-(2,2,4,4-tetramethylpentyl)imidazol-1-ium |
|---|---|
| PubChem CID | 174269412 |
| Molecular Formula | C20H29ClFN2+ |
| Molecular Weight | 351.92 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-3-(2,2,4,4-tetramethylpentyl)imidazol-1-ium |
| SMILES | Cc1n(CC(C)(C)CC(C)(C)C)cc[n+]1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C20H29ClFN2/c1-15-23(12-16-17(21)8-7-9-18(16)22)10-11-24(15)14-20(5,6)13-19(2,3)4/h7-11H,12-14H2,1-6H3/q+1 |
| InChIKey | UOZQEOWWYLSENH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.92 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|