C2H5NaO5S2 — CID 174270371
sodium;formic acid;methoxy-oxido-oxo-sulfanylidene-λ6-sulfane (PubChem CID 174270371) has the molecular formula C2H5NaO5S2 and a molecular weight of 196.18 g/mol. Its IUPAC name is sodium;formic acid;methoxy-oxido-oxo-sulfanylidene-λ6-sulfane.
| Compound Name | sodium;formic acid;methoxy-oxido-oxo-sulfanylidene-λ6-sulfane |
|---|---|
| PubChem CID | 174270371 |
| Molecular Formula | C2H5NaO5S2 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 195.95 |
| IUPAC Name | sodium;formic acid;methoxy-oxido-oxo-sulfanylidene-λ6-sulfane |
| SMILES | COS(=O)([O-])=S.O=CO.[Na+] |
| InChI | InChI=1S/CH4O3S2.CH2O2.Na/c1-4-6(2,3)5;2-1-3;/h1H3,(H,2,3,5);1H,(H,2,3);/q;;+1/p-1 |
| InChIKey | PHVDLRKPDYQXGH-UHFFFAOYSA-M |
| XLogP | -3.87 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | -3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|