C3H6NNaO4S2 — CID 88779845
sodium N-methyl-N-(oxidosulfonothioyloxymethyl)formamide (PubChem CID 88779845) has the molecular formula C3H6NNaO4S2 and a molecular weight of 207.21 g/mol. Its IUPAC name is sodium N-methyl-N-(oxidosulfonothioyloxymethyl)formamide.
| Compound Name | sodium N-methyl-N-(oxidosulfonothioyloxymethyl)formamide |
|---|---|
| PubChem CID | 88779845 |
| Molecular Formula | C3H6NNaO4S2 |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 206.96 |
| IUPAC Name | sodium N-methyl-N-(oxidosulfonothioyloxymethyl)formamide |
| SMILES | CN(C=O)COS(=O)([O-])=S.[Na+] |
| InChI | InChI=1S/C3H7NO4S2.Na/c1-4(2-5)3-8-10(6,7)9;/h2H,3H2,1H3,(H,6,7,9);/q;+1/p-1 |
| InChIKey | FEYAKPRELKGRHI-UHFFFAOYSA-M |
| XLogP | -4.16 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|