About sodium;dioxido-oxo-sulfanylidene-λ6-sulfane;ethylmercury(1+)
sodium;dioxido-oxo-sulfanylidene-λ6-sulfane;ethylmercury(1+) (PubChem CID 173390375) has the molecular formula C2H5HgNaO3S2
and a molecular weight of 364.77 g/mol. Its IUPAC name is sodium;dioxido-oxo-sulfanylidene-λ6-sulfane;ethylmercury(1+).
Molecular Properties
| Compound Name | sodium;dioxido-oxo-sulfanylidene-λ6-sulfane;ethylmercury(1+) |
| PubChem CID | 173390375 |
| Molecular Formula | C2H5HgNaO3S2 |
| Molecular Weight | 364.77 g/mol |
| Exact Mass | 365.93 |
| IUPAC Name | sodium;dioxido-oxo-sulfanylidene-λ6-sulfane;ethylmercury(1+) |
| SMILES | CC[Hg+].O=S([O-])([O-])=S.[Na+] |
| InChI | InChI=1S/C2H5.Hg.Na.H2O3S2/c1-2;;;1-5(2,3)4/h1H2,2H3;;;(H2,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | OTLMNTVDVXQSGA-UHFFFAOYSA-L |
| XLogP | -3.03 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.77 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;dioxido-oxo-sulfanylidene-λ6-sulfane;ethylmercury(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dioxido-oxo-sulfanylidene-λ6-sulfane;ethylmercury(1+)?
The IUPAC name of sodium;dioxido-oxo-sulfanylidene-λ6-sulfane;ethylmercury(1+) (CID 173390375) is sodium;dioxido-oxo-sulfanylidene-λ6-sulfane;ethylmercury(1+).
What is the SMILES notation for sodium;dioxido-oxo-sulfanylidene-λ6-sulfane;ethylmercury(1+)?
The canonical SMILES for sodium;dioxido-oxo-sulfanylidene-λ6-sulfane;ethylmercury(1+) is CC[Hg+].O=S([O-])([O-])=S.[Na+].
What is the InChIKey of sodium;dioxido-oxo-sulfanylidene-λ6-sulfane;ethylmercury(1+)?
The InChIKey is OTLMNTVDVXQSGA-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H5.Hg.Na.H2O3S2/c1-2;;;1-5(2,3)4/h1H2,2H3;;;(H2,1,2,3,4)/q;2*+1;/p-2.
What are the key properties of sodium;dioxido-oxo-sulfanylidene-λ6-sulfane;ethylmercury(1+)?
sodium;dioxido-oxo-sulfanylidene-λ6-sulfane;ethylmercury(1+) has a molecular weight of 364.77 g/mol, XLogP of -3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dioxido-oxo-sulfanylidene-λ6-sulfane;ethylmercury(1+) is sourced from PubChem (CID 173390375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).