C22H20N4O2S — CID 17427156
N-(5-benzyl-1,3-thiazol-2-yl)-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide (PubChem CID 17427156) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is N-(5-benzyl-1,3-thiazol-2-yl)-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide.
| Compound Name | N-(5-benzyl-1,3-thiazol-2-yl)-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide |
|---|---|
| PubChem CID | 17427156 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-(5-benzyl-1,3-thiazol-2-yl)-3-(8-methyl-4-oxoquinazolin-3-yl)propanamide |
| SMILES | Cc1cccc2c(=O)n(CCC(=O)Nc3ncc(Cc4ccccc4)s3)cnc12 |
| InChI | InChI=1S/C22H20N4O2S/c1-15-6-5-9-18-20(15)24-14-26(21(18)28)11-10-19(27)25-22-23-13-17(29-22)12-16-7-3-2-4-8-16/h2-9,13-14H,10-12H2,1H3,(H,23,25,27) |
| InChIKey | ZHAQIAKKQDFSSZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |