C26H34N2O11S — CID 174271771
7-[1-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-methylcarbamoyl]oxybut-3-enyl]-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-benzothiophene-2-carboxylic acid (PubChem CID 174271771) has the molecular formula C26H34N2O11S and a molecular weight of 582.63 g/mol. Its IUPAC name is 7-[1-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-methylcarbamoyl]oxybut-3-enyl]-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-benzothiophene-2-carboxylic acid.
| Compound Name | 7-[1-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-methylcarbamoyl]oxybut-3-enyl]-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 174271771 |
| Molecular Formula | C26H34N2O11S |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | 7-[1-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-methylcarbamoyl]oxybut-3-enyl]-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-benzothiophene-2-carboxylic acid |
| SMILES | C=CCC(OC(=O)N(C)[C@H](C(N)=O)C(C)C)c1ccc(O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)c2cc(C(=O)O)sc12 |
| InChI | InChI=1S/C26H34N2O11S/c1-5-6-14(39-26(36)28(4)18(11(2)3)23(27)33)12-7-8-15(13-9-17(24(34)35)40-22(12)13)37-25-21(32)20(31)19(30)16(10-29)38-25/h5,7-9,11,14,16,18-21,25,29-32H,1,6,10H2,2-4H3,(H2,27,33)(H,34,35)/t14?,16-,18+,19+,20+,21-,25-/m1/s1 |
| InChIKey | IENOGRJBRGFDLZ-OKJKZQCPSA-N |
| XLogP | 0.97 |
| TPSA | 209.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|