C27H38BrF2N3OSi — CID 174273189
[1-[2-[4-(3-azabicyclo[3.2.1]octan-3-yl)-7-bromo-6,8-difluoroquinazolin-2-yl]ethyl]cyclopropyl]methoxy-tert-butyl-dimethylsilane (PubChem CID 174273189) has the molecular formula C27H38BrF2N3OSi and a molecular weight of 566.61 g/mol. Its IUPAC name is [1-[2-[4-(3-azabicyclo[3.2.1]octan-3-yl)-7-bromo-6,8-difluoroquinazolin-2-yl]ethyl]cyclopropyl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [1-[2-[4-(3-azabicyclo[3.2.1]octan-3-yl)-7-bromo-6,8-difluoroquinazolin-2-yl]ethyl]cyclopropyl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 174273189 |
| Molecular Formula | C27H38BrF2N3OSi |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | [1-[2-[4-(3-azabicyclo[3.2.1]octan-3-yl)-7-bromo-6,8-difluoroquinazolin-2-yl]ethyl]cyclopropyl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1(CCc2nc(N3CC4CCC(C4)C3)c3cc(F)c(Br)c(F)c3n2)CC1 |
| InChI | InChI=1S/C27H38BrF2N3OSi/c1-26(2,3)35(4,5)34-16-27(10-11-27)9-8-21-31-24-19(13-20(29)22(28)23(24)30)25(32-21)33-14-17-6-7-18(12-17)15-33/h13,17-18H,6-12,14-16H2,1-5H3 |
| InChIKey | WBTNDSLWSHSZFA-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|