C16H12N4O4S — CID 174276389
4-[5-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyltetrazol-1-yl]benzaldehyde (PubChem CID 174276389) has the molecular formula C16H12N4O4S and a molecular weight of 356.36 g/mol. Its IUPAC name is 4-[5-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyltetrazol-1-yl]benzaldehyde.
| Compound Name | 4-[5-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyltetrazol-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 174276389 |
| Molecular Formula | C16H12N4O4S |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 4-[5-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]sulfanyltetrazol-1-yl]benzaldehyde |
| SMILES | O=Cc1ccc(-n2nnnc2SCC(=O)c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C16H12N4O4S/c21-8-10-1-4-12(5-2-10)20-16(17-18-19-20)25-9-15(24)11-3-6-13(22)14(23)7-11/h1-8,22-23H,9H2 |
| InChIKey | TYDGOHKGMZIAHQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|