C15H13N5O3S2 — CID 174276396
2-[1-(4-aminosulfanylphenyl)tetrazol-5-yl]sulfanyl-1-(3,4-dihydroxyphenyl)ethanone (PubChem CID 174276396) has the molecular formula C15H13N5O3S2 and a molecular weight of 375.44 g/mol. Its IUPAC name is 2-[1-(4-aminosulfanylphenyl)tetrazol-5-yl]sulfanyl-1-(3,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-[1-(4-aminosulfanylphenyl)tetrazol-5-yl]sulfanyl-1-(3,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 174276396 |
| Molecular Formula | C15H13N5O3S2 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 2-[1-(4-aminosulfanylphenyl)tetrazol-5-yl]sulfanyl-1-(3,4-dihydroxyphenyl)ethanone |
| SMILES | NSc1ccc(-n2nnnc2SCC(=O)c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C15H13N5O3S2/c16-25-11-4-2-10(3-5-11)20-15(17-18-19-20)24-8-14(23)9-1-6-12(21)13(22)7-9/h1-7,21-22H,8,16H2 |
| InChIKey | OVVLAJJKKUPBCP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|