C21H21ClN2O3 — CID 174276478
methyl 2-[1-(3-chloro-2,7-dimethyl-1-oxoisoquinolin-5-yl)ethylamino]benzoate (PubChem CID 174276478) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is methyl 2-[1-(3-chloro-2,7-dimethyl-1-oxoisoquinolin-5-yl)ethylamino]benzoate.
| Compound Name | methyl 2-[1-(3-chloro-2,7-dimethyl-1-oxoisoquinolin-5-yl)ethylamino]benzoate |
|---|---|
| PubChem CID | 174276478 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | methyl 2-[1-(3-chloro-2,7-dimethyl-1-oxoisoquinolin-5-yl)ethylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(C)c1cc(C)cc2c(=O)n(C)c(Cl)cc12 |
| InChI | InChI=1S/C21H21ClN2O3/c1-12-9-15(16-11-19(22)24(3)20(25)17(16)10-12)13(2)23-18-8-6-5-7-14(18)21(26)27-4/h5-11,13,23H,1-4H3 |
| InChIKey | HXFCDZDAUHPPAN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|