C24H27ClN2O3 — CID 174276336
butyl 2-[1-(3-chloro-2,7-dimethyl-1-oxoisoquinolin-5-yl)ethylamino]benzoate (PubChem CID 174276336) has the molecular formula C24H27ClN2O3 and a molecular weight of 426.94 g/mol. Its IUPAC name is butyl 2-[1-(3-chloro-2,7-dimethyl-1-oxoisoquinolin-5-yl)ethylamino]benzoate.
| Compound Name | butyl 2-[1-(3-chloro-2,7-dimethyl-1-oxoisoquinolin-5-yl)ethylamino]benzoate |
|---|---|
| PubChem CID | 174276336 |
| Molecular Formula | C24H27ClN2O3 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | butyl 2-[1-(3-chloro-2,7-dimethyl-1-oxoisoquinolin-5-yl)ethylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(C)c1cc(C)cc2c(=O)n(C)c(Cl)cc12 |
| InChI | InChI=1S/C24H27ClN2O3/c1-5-6-11-30-24(29)17-9-7-8-10-21(17)26-16(3)18-12-15(2)13-20-19(18)14-22(25)27(4)23(20)28/h7-10,12-14,16,26H,5-6,11H2,1-4H3 |
| InChIKey | UZKZIGYYUNGNGI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|