C30H35N3O5 — CID 54516189
dibutyl benzene-1,2-dicarboxylate;2,4-dimethyl-6-(7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-trien-8-yl)phenol (PubChem CID 54516189) has the molecular formula C30H35N3O5 and a molecular weight of 517.63 g/mol. Its IUPAC name is dibutyl benzene-1,2-dicarboxylate;2,4-dimethyl-6-(7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-trien-8-yl)phenol.
| Compound Name | dibutyl benzene-1,2-dicarboxylate;2,4-dimethyl-6-(7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-trien-8-yl)phenol |
|---|---|
| PubChem CID | 54516189 |
| Molecular Formula | C30H35N3O5 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | dibutyl benzene-1,2-dicarboxylate;2,4-dimethyl-6-(7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-trien-8-yl)phenol |
| SMILES | CCCCOC(=O)c1ccccc1C(=O)OCCCC.Cc1cc(C)c(O)c(-n2n3c4ccccc4n23)c1 |
| InChI | InChI=1S/C16H22O4.C14H13N3O/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2;1-9-7-10(2)14(18)13(8-9)17-15-11-5-3-4-6-12(11)16(15)17/h7-10H,3-6,11-12H2,1-2H3;3-8,18H,1-2H3 |
| InChIKey | YMOWYNFDABIDIF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|