About azanium;molybdenum(2+);arsorate
azanium;molybdenum(2+);arsorate (PubChem CID 174277284) has the molecular formula H4AsMoNO4
and a molecular weight of 252.90 g/mol. Its IUPAC name is azanium;molybdenum(2+);arsorate.
Molecular Properties
| Compound Name | azanium;molybdenum(2+);arsorate |
| PubChem CID | 174277284 |
| Molecular Formula | H4AsMoNO4 |
| Molecular Weight | 252.90 g/mol |
| Exact Mass | 254.84 |
| IUPAC Name | azanium;molybdenum(2+);arsorate |
| SMILES | O=[As]([O-])([O-])[O-].[Mo+2].[NH4+] |
| InChI | InChI=1S/AsH3O4.Mo.H3N/c2-1(3,4)5;;/h(H3,2,3,4,5);;1H3/q;+2;/p-2 |
| InChIKey | OITLAZZUYRQDPQ-UHFFFAOYSA-L |
| XLogP | -3.69 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.90 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azanium;molybdenum(2+);arsorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;molybdenum(2+);arsorate?
The IUPAC name of azanium;molybdenum(2+);arsorate (CID 174277284) is azanium;molybdenum(2+);arsorate.
What is the SMILES notation for azanium;molybdenum(2+);arsorate?
The canonical SMILES for azanium;molybdenum(2+);arsorate is O=[As]([O-])([O-])[O-].[Mo+2].[NH4+].
What is the InChIKey of azanium;molybdenum(2+);arsorate?
The InChIKey is OITLAZZUYRQDPQ-UHFFFAOYSA-L. The full InChI is InChI=1S/AsH3O4.Mo.H3N/c2-1(3,4)5;;/h(H3,2,3,4,5);;1H3/q;+2;/p-2.
What are the key properties of azanium;molybdenum(2+);arsorate?
azanium;molybdenum(2+);arsorate has a molecular weight of 252.90 g/mol, XLogP of -3.69, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;molybdenum(2+);arsorate is sourced from PubChem (CID 174277284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).