About diazanium;arsorate
diazanium;arsorate (PubChem CID 23618854) has the molecular formula H8AsN2O4-
and a molecular weight of 175.00 g/mol. Its IUPAC name is diazanium;arsorate.
Molecular Properties
| Compound Name | diazanium;arsorate |
| PubChem CID | 23618854 |
| Molecular Formula | H8AsN2O4- |
| Molecular Weight | 175.00 g/mol |
| Exact Mass | 174.97 |
| IUPAC Name | diazanium;arsorate |
| SMILES | O=[As]([O-])([O-])[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/AsH3O4.2H3N/c2-1(3,4)5;;/h(H3,2,3,4,5);2*1H3/p-1 |
| InChIKey | XPVHUBFHKQQSDA-UHFFFAOYSA-M |
| XLogP | -3.31 |
| TPSA | 159.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.00 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diazanium;arsorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;arsorate?
The IUPAC name of diazanium;arsorate (CID 23618854) is diazanium;arsorate.
What is the SMILES notation for diazanium;arsorate?
The canonical SMILES for diazanium;arsorate is O=[As]([O-])([O-])[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;arsorate?
The InChIKey is XPVHUBFHKQQSDA-UHFFFAOYSA-M. The full InChI is InChI=1S/AsH3O4.2H3N/c2-1(3,4)5;;/h(H3,2,3,4,5);2*1H3/p-1.
What are the key properties of diazanium;arsorate?
diazanium;arsorate has a molecular weight of 175.00 g/mol, XLogP of -3.31, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;arsorate is sourced from PubChem (CID 23618854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).