About N-ethyl-N-propan-2-ylpropan-2-amine;titanium;hydrochloride
N-ethyl-N-propan-2-ylpropan-2-amine;titanium;hydrochloride (PubChem CID 174277868) has the molecular formula C8H19ClNTi-
and a molecular weight of 212.57 g/mol. Its IUPAC name is N-ethyl-N-propan-2-ylpropan-2-amine;titanium;hydrochloride.
Molecular Properties
| Compound Name | N-ethyl-N-propan-2-ylpropan-2-amine;titanium;hydrochloride |
| PubChem CID | 174277868 |
| Molecular Formula | C8H19ClNTi- |
| Molecular Weight | 212.57 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | N-ethyl-N-propan-2-ylpropan-2-amine;titanium;hydrochloride |
| SMILES | C[CH-]N(C(C)C)C(C)C.Cl.[Ti] |
| InChI | InChI=1S/C8H18N.ClH.Ti/c1-6-9(7(2)3)8(4)5;;/h6-8H,1-5H3;1H;/q-1;; |
| InChIKey | BZIUQQSNASABJA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.57 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-propan-2-ylpropan-2-amine;titanium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-propan-2-ylpropan-2-amine;titanium;hydrochloride?
The IUPAC name of N-ethyl-N-propan-2-ylpropan-2-amine;titanium;hydrochloride (CID 174277868) is N-ethyl-N-propan-2-ylpropan-2-amine;titanium;hydrochloride.
What is the SMILES notation for N-ethyl-N-propan-2-ylpropan-2-amine;titanium;hydrochloride?
The canonical SMILES for N-ethyl-N-propan-2-ylpropan-2-amine;titanium;hydrochloride is C[CH-]N(C(C)C)C(C)C.Cl.[Ti].
What is the InChIKey of N-ethyl-N-propan-2-ylpropan-2-amine;titanium;hydrochloride?
The InChIKey is BZIUQQSNASABJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N.ClH.Ti/c1-6-9(7(2)3)8(4)5;;/h6-8H,1-5H3;1H;/q-1;;.
What are the key properties of N-ethyl-N-propan-2-ylpropan-2-amine;titanium;hydrochloride?
N-ethyl-N-propan-2-ylpropan-2-amine;titanium;hydrochloride has a molecular weight of 212.57 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-propan-2-ylpropan-2-amine;titanium;hydrochloride is sourced from PubChem (CID 174277868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).