About lithium;N-ethyl-N-propan-2-ylpropan-2-amine;hexane
lithium;N-ethyl-N-propan-2-ylpropan-2-amine;hexane (PubChem CID 174508922) has the molecular formula C14H32LiN
and a molecular weight of 221.36 g/mol. Its IUPAC name is lithium;N-ethyl-N-propan-2-ylpropan-2-amine;hexane.
Molecular Properties
| Compound Name | lithium;N-ethyl-N-propan-2-ylpropan-2-amine;hexane |
| PubChem CID | 174508922 |
| Molecular Formula | C14H32LiN |
| Molecular Weight | 221.36 g/mol |
| Exact Mass | 221.27 |
| IUPAC Name | lithium;N-ethyl-N-propan-2-ylpropan-2-amine;hexane |
| SMILES | CCCCCC.C[CH-]N(C(C)C)C(C)C.[Li+] |
| InChI | InChI=1S/C8H18N.C6H14.Li/c1-6-9(7(2)3)8(4)5;1-3-5-6-4-2;/h6-8H,1-5H3;3-6H2,1-2H3;/q-1;;+1 |
| InChIKey | ZAVNEKWNXBLTFU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;N-ethyl-N-propan-2-ylpropan-2-amine;hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;N-ethyl-N-propan-2-ylpropan-2-amine;hexane?
The IUPAC name of lithium;N-ethyl-N-propan-2-ylpropan-2-amine;hexane (CID 174508922) is lithium;N-ethyl-N-propan-2-ylpropan-2-amine;hexane.
What is the SMILES notation for lithium;N-ethyl-N-propan-2-ylpropan-2-amine;hexane?
The canonical SMILES for lithium;N-ethyl-N-propan-2-ylpropan-2-amine;hexane is CCCCCC.C[CH-]N(C(C)C)C(C)C.[Li+].
What is the InChIKey of lithium;N-ethyl-N-propan-2-ylpropan-2-amine;hexane?
The InChIKey is ZAVNEKWNXBLTFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N.C6H14.Li/c1-6-9(7(2)3)8(4)5;1-3-5-6-4-2;/h6-8H,1-5H3;3-6H2,1-2H3;/q-1;;+1.
What are the key properties of lithium;N-ethyl-N-propan-2-ylpropan-2-amine;hexane?
lithium;N-ethyl-N-propan-2-ylpropan-2-amine;hexane has a molecular weight of 221.36 g/mol, XLogP of 1.88, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;N-ethyl-N-propan-2-ylpropan-2-amine;hexane is sourced from PubChem (CID 174508922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).