C23H32O3 — CID 174278458
3-hydroxy-3-propan-2-ylhexane-2,5-dione;toluene (PubChem CID 174278458) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is 3-hydroxy-3-propan-2-ylhexane-2,5-dione;toluene.
| Compound Name | 3-hydroxy-3-propan-2-ylhexane-2,5-dione;toluene |
|---|---|
| PubChem CID | 174278458 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 3-hydroxy-3-propan-2-ylhexane-2,5-dione;toluene |
| SMILES | CC(=O)CC(O)(C(C)=O)C(C)C.Cc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C9H16O3.2C7H8/c1-6(2)9(12,8(4)11)5-7(3)10;2*1-7-5-3-2-4-6-7/h6,12H,5H2,1-4H3;2*2-6H,1H3 |
| InChIKey | PBSOKURNXLNSFC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |