C51H36N4O6S — CID 174281783
N-[amino(phenyl)methylidene]-N'-[[4-dibenzothiophen-4-yl-2-(1,3,4,5,6,8-hexahydroxycarbazol-9-yl)phenyl]methyl]-4-phenylbenzenecarboximidamide (PubChem CID 174281783) has the molecular formula C51H36N4O6S and a molecular weight of 832.94 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-N'-[[4-dibenzothiophen-4-yl-2-(1,3,4,5,6,8-hexahydroxycarbazol-9-yl)phenyl]methyl]-4-phenylbenzenecarboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-N'-[[4-dibenzothiophen-4-yl-2-(1,3,4,5,6,8-hexahydroxycarbazol-9-yl)phenyl]methyl]-4-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 174281783 |
| Molecular Formula | C51H36N4O6S |
| Molecular Weight | 832.94 g/mol |
| Exact Mass | 832.24 |
| IUPAC Name | N-[amino(phenyl)methylidene]-N'-[[4-dibenzothiophen-4-yl-2-(1,3,4,5,6,8-hexahydroxycarbazol-9-yl)phenyl]methyl]-4-phenylbenzenecarboximidamide |
| SMILES | N/C(=N\C(=N/Cc1ccc(-c2cccc3c2sc2ccccc23)cc1-n1c2c(O)cc(O)c(O)c2c2c(O)c(O)cc(O)c21)c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C51H36N4O6S/c52-50(30-12-5-2-6-13-30)54-51(31-20-18-29(19-21-31)28-10-3-1-4-11-28)53-27-33-23-22-32(34-15-9-16-36-35-14-7-8-17-42(35)62-49(34)36)24-37(33)55-45-38(56)25-40(58)47(60)43(45)44-46(55)39(57)26-41(59)48(44)61/h1-26,56-61H,27H2,(H2,52,53,54) |
| InChIKey | HFBQEMIEDJQYBJ-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 177.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.94 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|