C24H27NO3 — CID 174282394
3-[2-(4-phenylmethoxyphenyl)ethyl-propylamino]benzene-1,2-diol (PubChem CID 174282394) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 3-[2-(4-phenylmethoxyphenyl)ethyl-propylamino]benzene-1,2-diol.
| Compound Name | 3-[2-(4-phenylmethoxyphenyl)ethyl-propylamino]benzene-1,2-diol |
|---|---|
| PubChem CID | 174282394 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 3-[2-(4-phenylmethoxyphenyl)ethyl-propylamino]benzene-1,2-diol |
| SMILES | CCCN(CCc1ccc(OCc2ccccc2)cc1)c1cccc(O)c1O |
| InChI | InChI=1S/C24H27NO3/c1-2-16-25(22-9-6-10-23(26)24(22)27)17-15-19-11-13-21(14-12-19)28-18-20-7-4-3-5-8-20/h3-14,26-27H,2,15-18H2,1H3 |
| InChIKey | LLYWLEUHPLFSNR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|