C20H21NO6 — CID 57289542
6-[2-(2,3-dihydroxy-N-propylanilino)ethoxy]-1-benzofuran-2-carboxylic acid (PubChem CID 57289542) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is 6-[2-(2,3-dihydroxy-N-propylanilino)ethoxy]-1-benzofuran-2-carboxylic acid.
| Compound Name | 6-[2-(2,3-dihydroxy-N-propylanilino)ethoxy]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 57289542 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 6-[2-(2,3-dihydroxy-N-propylanilino)ethoxy]-1-benzofuran-2-carboxylic acid |
| SMILES | CCCN(CCOc1ccc2cc(C(=O)O)oc2c1)c1cccc(O)c1O |
| InChI | InChI=1S/C20H21NO6/c1-2-8-21(15-4-3-5-16(22)19(15)23)9-10-26-14-7-6-13-11-18(20(24)25)27-17(13)12-14/h3-7,11-12,22-23H,2,8-10H2,1H3,(H,24,25) |
| InChIKey | VBXJWPGCSBVSMW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|