C24H28O4 — CID 70101078
5-(4-nonoxyphenyl)-1-benzofuran-2-carboxylic acid (PubChem CID 70101078) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is 5-(4-nonoxyphenyl)-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-(4-nonoxyphenyl)-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 70101078 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 5-(4-nonoxyphenyl)-1-benzofuran-2-carboxylic acid |
| SMILES | CCCCCCCCCOc1ccc(-c2ccc3oc(C(=O)O)cc3c2)cc1 |
| InChI | InChI=1S/C24H28O4/c1-2-3-4-5-6-7-8-15-27-21-12-9-18(10-13-21)19-11-14-22-20(16-19)17-23(28-22)24(25)26/h9-14,16-17H,2-8,15H2,1H3,(H,25,26) |
| InChIKey | KYFXGORAMLGUPS-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|