C18H21F2N3O — CID 174284643
6-[(3,3-difluoropyrrolidin-1-yl)methyl]-2-(oxan-4-yl)quinazoline (PubChem CID 174284643) has the molecular formula C18H21F2N3O and a molecular weight of 333.38 g/mol. Its IUPAC name is 6-[(3,3-difluoropyrrolidin-1-yl)methyl]-2-(oxan-4-yl)quinazoline.
| Compound Name | 6-[(3,3-difluoropyrrolidin-1-yl)methyl]-2-(oxan-4-yl)quinazoline |
|---|---|
| PubChem CID | 174284643 |
| Molecular Formula | C18H21F2N3O |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 6-[(3,3-difluoropyrrolidin-1-yl)methyl]-2-(oxan-4-yl)quinazoline |
| SMILES | FC1(F)CCN(Cc2ccc3nc(C4CCOCC4)ncc3c2)C1 |
| InChI | InChI=1S/C18H21F2N3O/c19-18(20)5-6-23(12-18)11-13-1-2-16-15(9-13)10-21-17(22-16)14-3-7-24-8-4-14/h1-2,9-10,14H,3-8,11-12H2 |
| InChIKey | NYRNDIPBDKOLKK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |