C12H10N3OS+ — CID 174285816
oxo-[(6-pyrrol-1-yl-1H-benzimidazol-2-yl)methyl]sulfanium (PubChem CID 174285816) has the molecular formula C12H10N3OS+ and a molecular weight of 244.30 g/mol. Its IUPAC name is oxo-[(6-pyrrol-1-yl-1H-benzimidazol-2-yl)methyl]sulfanium.
| Compound Name | oxo-[(6-pyrrol-1-yl-1H-benzimidazol-2-yl)methyl]sulfanium |
|---|---|
| PubChem CID | 174285816 |
| Molecular Formula | C12H10N3OS+ |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | oxo-[(6-pyrrol-1-yl-1H-benzimidazol-2-yl)methyl]sulfanium |
| SMILES | O=[S+]Cc1nc2ccc(-n3cccc3)cc2[nH]1 |
| InChI | InChI=1S/C12H10N3OS/c16-17-8-12-13-10-4-3-9(7-11(10)14-12)15-5-1-2-6-15/h1-7H,8H2,(H,13,14)/q+1 |
| InChIKey | CFYNEGDESSVZHQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|