C13H20O2S — CID 174290006
4-methyl-3-(2-methylpentan-2-yl)benzenesulfinic acid (PubChem CID 174290006) has the molecular formula C13H20O2S and a molecular weight of 240.37 g/mol. Its IUPAC name is 4-methyl-3-(2-methylpentan-2-yl)benzenesulfinic acid.
| Compound Name | 4-methyl-3-(2-methylpentan-2-yl)benzenesulfinic acid |
|---|---|
| PubChem CID | 174290006 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 4-methyl-3-(2-methylpentan-2-yl)benzenesulfinic acid |
| SMILES | CCCC(C)(C)c1cc(S(=O)O)ccc1C |
| InChI | InChI=1S/C13H20O2S/c1-5-8-13(3,4)12-9-11(16(14)15)7-6-10(12)2/h6-7,9H,5,8H2,1-4H3,(H,14,15) |
| InChIKey | PWGFLKBQGQOAHX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|