About disodium;chloro hydrogen carbonate;hydride
disodium;chloro hydrogen carbonate;hydride (PubChem CID 174295401) has the molecular formula CH3ClNa2O3
and a molecular weight of 144.47 g/mol. Its IUPAC name is disodium;chloro hydrogen carbonate;hydride.
Molecular Properties
| Compound Name | disodium;chloro hydrogen carbonate;hydride |
| PubChem CID | 174295401 |
| Molecular Formula | CH3ClNa2O3 |
| Molecular Weight | 144.47 g/mol |
| Exact Mass | 143.96 |
| IUPAC Name | disodium;chloro hydrogen carbonate;hydride |
| SMILES | O=C(O)OCl.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/CHClO3.2Na.2H/c2-5-1(3)4;;;;/h(H,3,4);;;;/q;2*+1;2*-1 |
| InChIKey | DDWQKSGFDKFRCW-UHFFFAOYSA-N |
| XLogP | -4.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.47 |
| LogP ≤ 5 | -4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze disodium;chloro hydrogen carbonate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;chloro hydrogen carbonate;hydride?
The IUPAC name of disodium;chloro hydrogen carbonate;hydride (CID 174295401) is disodium;chloro hydrogen carbonate;hydride.
What is the SMILES notation for disodium;chloro hydrogen carbonate;hydride?
The canonical SMILES for disodium;chloro hydrogen carbonate;hydride is O=C(O)OCl.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;chloro hydrogen carbonate;hydride?
The InChIKey is DDWQKSGFDKFRCW-UHFFFAOYSA-N. The full InChI is InChI=1S/CHClO3.2Na.2H/c2-5-1(3)4;;;;/h(H,3,4);;;;/q;2*+1;2*-1.
What are the key properties of disodium;chloro hydrogen carbonate;hydride?
disodium;chloro hydrogen carbonate;hydride has a molecular weight of 144.47 g/mol, XLogP of -4.93, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;chloro hydrogen carbonate;hydride is sourced from PubChem (CID 174295401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).