C13H26N2 — CID 174296005
4-tert-butyl-7-propyl-4,7-diazaspiro[2.5]octane (PubChem CID 174296005) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 4-tert-butyl-7-propyl-4,7-diazaspiro[2.5]octane.
| Compound Name | 4-tert-butyl-7-propyl-4,7-diazaspiro[2.5]octane |
|---|---|
| PubChem CID | 174296005 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 4-tert-butyl-7-propyl-4,7-diazaspiro[2.5]octane |
| SMILES | CCCN1CCN(C(C)(C)C)C2(CC2)C1 |
| InChI | InChI=1S/C13H26N2/c1-5-8-14-9-10-15(12(2,3)4)13(11-14)6-7-13/h5-11H2,1-4H3 |
| InChIKey | ZPJGLUFMRMNQGW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |